C21H34O2 — CID 10236671
(2R,3R,6R,9S,14R)-3-hydroxy-2,6,9,11,11,14-hexamethyltetracyclo[7.6.0.01,6.010,14]pentadecan-5-one (PubChem CID 10236671) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (2R,3R,6R,9S,14R)-3-hydroxy-2,6,9,11,11,14-hexamethyltetracyclo[7.6.0.01,6.010,14]pentadecan-5-one.
| Compound Name | (2R,3R,6R,9S,14R)-3-hydroxy-2,6,9,11,11,14-hexamethyltetracyclo[7.6.0.01,6.010,14]pentadecan-5-one |
|---|---|
| PubChem CID | 10236671 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (2R,3R,6R,9S,14R)-3-hydroxy-2,6,9,11,11,14-hexamethyltetracyclo[7.6.0.01,6.010,14]pentadecan-5-one |
| SMILES | C[C@H]1[C@H](O)CC(=O)[C@]2(C)CC[C@@]3(C)C4C(C)(C)CC[C@]4(C)CC123 |
| InChI | InChI=1S/C21H34O2/c1-13-14(22)11-15(23)19(5)9-10-20(6)16-17(2,3)7-8-18(16,4)12-21(13,19)20/h13-14,16,22H,7-12H2,1-6H3/t13-,14+,16?,18+,19-,20-,21?/m0/s1 |
| InChIKey | MRYWJMPPFPQFKC-WPEYFLMISA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |