C18H17NO3 — CID 102366773
butyl (2Z)-2-(1-oxobenzo[e]isoindol-3-ylidene)acetate (PubChem CID 102366773) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is butyl (2Z)-2-(1-oxobenzo[e]isoindol-3-ylidene)acetate.
| Compound Name | butyl (2Z)-2-(1-oxobenzo[e]isoindol-3-ylidene)acetate |
|---|---|
| PubChem CID | 102366773 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | butyl (2Z)-2-(1-oxobenzo[e]isoindol-3-ylidene)acetate |
| SMILES | CCCCOC(=O)/C=C1\NC(=O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C18H17NO3/c1-2-3-10-22-16(20)11-15-14-9-8-12-6-4-5-7-13(12)17(14)18(21)19-15/h4-9,11H,2-3,10H2,1H3,(H,19,21)/b15-11- |
| InChIKey | IJNXYPFELQYSHA-PTNGSMBKSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|