C17H19N3O2 — CID 11197263
butyl (2E)-2-(8-methyl-1,9-dihydropyrazolo[4,5-h]quinolin-6-ylidene)acetate (PubChem CID 11197263) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is butyl (2E)-2-(8-methyl-1,9-dihydropyrazolo[4,5-h]quinolin-6-ylidene)acetate.
| Compound Name | butyl (2E)-2-(8-methyl-1,9-dihydropyrazolo[4,5-h]quinolin-6-ylidene)acetate |
|---|---|
| PubChem CID | 11197263 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | butyl (2E)-2-(8-methyl-1,9-dihydropyrazolo[4,5-h]quinolin-6-ylidene)acetate |
| SMILES | CCCCOC(=O)/C=C1\C=C(C)Nc2c1ccc1cn[nH]c21 |
| InChI | InChI=1S/C17H19N3O2/c1-3-4-7-22-15(21)9-13-8-11(2)19-17-14(13)6-5-12-10-18-20-16(12)17/h5-6,8-10,19H,3-4,7H2,1-2H3,(H,18,20)/b13-9+ |
| InChIKey | UNNZZQZUPATRQT-UKTHLTGXSA-N |
| XLogP | 3.62 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|