About cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate
cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate (PubChem CID 102370573) has the molecular formula C25H50O2Si
and a molecular weight of 410.76 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate |
| PubChem CID | 102370573 |
| Molecular Formula | C25H50O2Si |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate |
| SMILES | CCCCCC[Si](CCCCCC)(CCCCCC)[C@H]1CC[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C25H50O2Si/c1-5-8-11-14-19-28(20-15-12-9-6-2,21-16-13-10-7-3)24-18-17-23(22-24)25(26)27-4/h23-24H,5-22H2,1-4H3/t23-,24+/m1/s1 |
| InChIKey | VNMRZQBLGHTYBG-RPWUZVMVSA-N |
| XLogP | 8.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate (CID 102370573) is cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate is CCCCCC[Si](CCCCCC)(CCCCCC)[C@H]1CC[C@@H](C(=O)OC)C1.
What is the InChIKey of cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate?
The InChIKey is VNMRZQBLGHTYBG-RPWUZVMVSA-N. The full InChI is InChI=1S/C25H50O2Si/c1-5-8-11-14-19-28(20-15-12-9-6-2,21-16-13-10-7-3)24-18-17-23(22-24)25(26)27-4/h23-24H,5-22H2,1-4H3/t23-,24+/m1/s1.
What are the key properties of cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate?
cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate has a molecular weight of 410.76 g/mol, XLogP of 8.52, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,3S)-3-trihexylsilylcyclopentane-1-carboxylate is sourced from PubChem (CID 102370573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).