C24H38O4 — CID 102371776
[(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-hydroxybutyl] 2,2-dimethylpropanoate (PubChem CID 102371776) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-hydroxybutyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-hydroxybutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102371776 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-hydroxybutyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@H]1O[C@@H]([C@](C)(O)CCOC(=O)C(C)(C)C)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C24H38O4/c1-9-10-18-19-16(4)11-12-17(15(2)3)20(19)21(28-18)24(8,26)13-14-27-22(25)23(5,6)7/h1,11,15,17-21,26H,10,12-14H2,2-8H3/t17-,18-,19-,20-,21-,24-/m1/s1 |
| InChIKey | DRVNYLGAYUEJDX-MQJSGXSGSA-N |
| XLogP | 4.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|