C10H19NS — CID 102372571
(4R,5R)-2-methyl-4,5-dipropyl-4,5-dihydro-1,3-thiazole (PubChem CID 102372571) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (4R,5R)-2-methyl-4,5-dipropyl-4,5-dihydro-1,3-thiazole.
| Compound Name | (4R,5R)-2-methyl-4,5-dipropyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 102372571 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (4R,5R)-2-methyl-4,5-dipropyl-4,5-dihydro-1,3-thiazole |
| SMILES | CCC[C@H]1N=C(C)S[C@@H]1CCC |
| InChI | InChI=1S/C10H19NS/c1-4-6-9-10(7-5-2)12-8(3)11-9/h9-10H,4-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | QGCIHWSZSQLHCC-NXEZZACHSA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |