C10H20S2 — CID 643418
(2R,3S)-2,3-dipropyl-1,4-dithiane (PubChem CID 643418) has the molecular formula C10H20S2 and a molecular weight of 204.40 g/mol. Its IUPAC name is (2R,3S)-2,3-dipropyl-1,4-dithiane.
| Compound Name | (2R,3S)-2,3-dipropyl-1,4-dithiane |
|---|---|
| PubChem CID | 643418 |
| Molecular Formula | C10H20S2 |
| Molecular Weight | 204.40 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2R,3S)-2,3-dipropyl-1,4-dithiane |
| SMILES | CCC[C@@H]1SCCS[C@@H]1CCC |
| InChI | InChI=1S/C10H20S2/c1-3-5-9-10(6-4-2)12-8-7-11-9/h9-10H,3-8H2,1-2H3/t9-,10+ |
| InChIKey | VECHIVASABVJRM-AOOOYVTPSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |