C9H13NO2S — CID 163902709
1-[4-(1-hydroxyethenyl)-2-methyl-4,5-dihydro-1,3-thiazol-5-yl]propan-1-one (PubChem CID 163902709) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethenyl)-2-methyl-4,5-dihydro-1,3-thiazol-5-yl]propan-1-one.
| Compound Name | 1-[4-(1-hydroxyethenyl)-2-methyl-4,5-dihydro-1,3-thiazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 163902709 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-[4-(1-hydroxyethenyl)-2-methyl-4,5-dihydro-1,3-thiazol-5-yl]propan-1-one |
| SMILES | C=C(O)C1N=C(C)SC1C(=O)CC |
| InChI | InChI=1S/C9H13NO2S/c1-4-7(12)9-8(5(2)11)10-6(3)13-9/h8-9,11H,2,4H2,1,3H3 |
| InChIKey | QLGCUAWFASWYHU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|