C6H9ClN2O2S — CID 89024766
ethyl 2-amino-5-chloro-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 89024766) has the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. Its IUPAC name is ethyl 2-amino-5-chloro-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-chloro-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 89024766 |
| Molecular Formula | C6H9ClN2O2S |
| Molecular Weight | 208.67 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | ethyl 2-amino-5-chloro-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1N=C(N)SC1Cl |
| InChI | InChI=1S/C6H9ClN2O2S/c1-2-11-5(10)3-4(7)12-6(8)9-3/h3-4H,2H2,1H3,(H2,8,9) |
| InChIKey | GZSAKKCFGXPZEI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.67 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|