C12H19N3O4S — CID 124926480
diethyl (4R,5R)-2-(2-propan-2-ylidenehydrazinyl)-4,5-dihydro-1,3-thiazole-4,5-dicarboxylate (PubChem CID 124926480) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is diethyl (4R,5R)-2-(2-propan-2-ylidenehydrazinyl)-4,5-dihydro-1,3-thiazole-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-(2-propan-2-ylidenehydrazinyl)-4,5-dihydro-1,3-thiazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 124926480 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | diethyl (4R,5R)-2-(2-propan-2-ylidenehydrazinyl)-4,5-dihydro-1,3-thiazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1N=C(NN=C(C)C)S[C@H]1C(=O)OCC |
| InChI | InChI=1S/C12H19N3O4S/c1-5-18-10(16)8-9(11(17)19-6-2)20-12(13-8)15-14-7(3)4/h8-9H,5-6H2,1-4H3,(H,13,15)/t8-,9+/m0/s1 |
| InChIKey | JBHPPLSBRAHOPJ-DTWKUNHWSA-N |
| XLogP | 0.94 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|