C15H18N2O7S2 — CID 122379425
diethyl (4R,5R)-2-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-dithiolane-4,5-dicarboxylate (PubChem CID 122379425) has the molecular formula C15H18N2O7S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is diethyl (4R,5R)-2-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-dithiolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-dithiolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 122379425 |
| Molecular Formula | C15H18N2O7S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | diethyl (4R,5R)-2-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-dithiolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1SC(=C2C(=O)N(C)C(=O)N(C)C2=O)S[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C15H18N2O7S2/c1-5-23-12(20)8-9(13(21)24-6-2)26-14(25-8)7-10(18)16(3)15(22)17(4)11(7)19/h8-9H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | UYMLJIBHEIPRRM-IUCAKERBSA-N |
| XLogP | 0.59 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|