C18H32N4O6S2 — CID 67763241
but-2-enedioic acid;bis(4-ethoxy-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine) (PubChem CID 67763241) has the molecular formula C18H32N4O6S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is but-2-enedioic acid;bis(4-ethoxy-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine).
| Compound Name | but-2-enedioic acid;bis(4-ethoxy-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine) |
|---|---|
| PubChem CID | 67763241 |
| Molecular Formula | C18H32N4O6S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | but-2-enedioic acid;bis(4-ethoxy-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine) |
| SMILES | CCOC1CC(C)SC(N)=N1.CCOC1CC(C)SC(N)=N1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C7H14N2OS.C4H4O4/c2*1-3-10-6-4-5(2)11-7(8)9-6;5-3(6)1-2-4(7)8/h2*5-6H,3-4H2,1-2H3,(H2,8,9);1-2H,(H,5,6)(H,7,8) |
| InChIKey | WVTRKOZDNAGWRP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 169.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|