C28H24F2O2Si — CID 102374589
2,2-difluoro-3-hydroxy-3-(2-methylphenyl)-1-triphenylsilylpropan-1-one (PubChem CID 102374589) has the molecular formula C28H24F2O2Si and a molecular weight of 458.58 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-(2-methylphenyl)-1-triphenylsilylpropan-1-one.
| Compound Name | 2,2-difluoro-3-hydroxy-3-(2-methylphenyl)-1-triphenylsilylpropan-1-one |
|---|---|
| PubChem CID | 102374589 |
| Molecular Formula | C28H24F2O2Si |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-(2-methylphenyl)-1-triphenylsilylpropan-1-one |
| SMILES | Cc1ccccc1C(O)C(F)(F)C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24F2O2Si/c1-21-13-11-12-20-25(21)26(31)28(29,30)27(32)33(22-14-5-2-6-15-22,23-16-7-3-8-17-23)24-18-9-4-10-19-24/h2-20,26,31H,1H3 |
| InChIKey | PDVLPRUIJAHKGM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|