C24H23N — CID 102375033
N-benzyl-1-[(2S)-2-phenyl-2,3-dihydro-1H-inden-4-yl]ethanimine (PubChem CID 102375033) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is N-benzyl-1-[(2S)-2-phenyl-2,3-dihydro-1H-inden-4-yl]ethanimine.
| Compound Name | N-benzyl-1-[(2S)-2-phenyl-2,3-dihydro-1H-inden-4-yl]ethanimine |
|---|---|
| PubChem CID | 102375033 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-benzyl-1-[(2S)-2-phenyl-2,3-dihydro-1H-inden-4-yl]ethanimine |
| SMILES | C/C(=N\Cc1ccccc1)c1cccc2c1C[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C24H23N/c1-18(25-17-19-9-4-2-5-10-19)23-14-8-13-21-15-22(16-24(21)23)20-11-6-3-7-12-20/h2-14,22H,15-17H2,1H3/b25-18+/t22-/m0/s1 |
| InChIKey | VLAZGZWBPVSZNM-BOJFNEGLSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|