C19H20F3NOS — CID 102377475
N-cyclohexyl-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-imine (PubChem CID 102377475) has the molecular formula C19H20F3NOS and a molecular weight of 367.44 g/mol. Its IUPAC name is N-cyclohexyl-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-imine.
| Compound Name | N-cyclohexyl-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-imine |
|---|---|
| PubChem CID | 102377475 |
| Molecular Formula | C19H20F3NOS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-cyclohexyl-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-imine |
| SMILES | O=S(C/C(=N/C1CCCCC1)C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H20F3NOS/c20-19(21,22)18(23-15-9-2-1-3-10-15)13-25(24)17-12-6-8-14-7-4-5-11-16(14)17/h4-8,11-12,15H,1-3,9-10,13H2/b23-18- |
| InChIKey | KUUMADQIZRIPLX-NKFKGCMQSA-N |
| XLogP | 5.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|