C21H18ClF2NO3S — CID 11282047
benzyl N-[(2R)-1-chloro-1,1-difluoro-3-[(S)-naphthalen-1-ylsulfinyl]propan-2-yl]carbamate (PubChem CID 11282047) has the molecular formula C21H18ClF2NO3S and a molecular weight of 437.90 g/mol. Its IUPAC name is benzyl N-[(2R)-1-chloro-1,1-difluoro-3-[(S)-naphthalen-1-ylsulfinyl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-chloro-1,1-difluoro-3-[(S)-naphthalen-1-ylsulfinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 11282047 |
| Molecular Formula | C21H18ClF2NO3S |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | benzyl N-[(2R)-1-chloro-1,1-difluoro-3-[(S)-naphthalen-1-ylsulfinyl]propan-2-yl]carbamate |
| SMILES | O=C(N[C@H](C[S@](=O)c1cccc2ccccc12)C(F)(F)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C21H18ClF2NO3S/c22-21(23,24)19(25-20(26)28-13-15-7-2-1-3-8-15)14-29(27)18-12-6-10-16-9-4-5-11-17(16)18/h1-12,19H,13-14H2,(H,25,26)/t19-,29+/m1/s1 |
| InChIKey | AULBPPCTVFMBKU-XBBWARJSSA-N |
| XLogP | 5.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|