C13H14F3NO5 — CID 175256770
3-(phenylmethoxycarbonylamino)-3-(2,2,2-trifluoroethoxy)propanoic acid (PubChem CID 175256770) has the molecular formula C13H14F3NO5 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-(phenylmethoxycarbonylamino)-3-(2,2,2-trifluoroethoxy)propanoic acid.
| Compound Name | 3-(phenylmethoxycarbonylamino)-3-(2,2,2-trifluoroethoxy)propanoic acid |
|---|---|
| PubChem CID | 175256770 |
| Molecular Formula | C13H14F3NO5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(phenylmethoxycarbonylamino)-3-(2,2,2-trifluoroethoxy)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO5/c14-13(15,16)8-22-10(6-11(18)19)17-12(20)21-7-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,17,20)(H,18,19) |
| InChIKey | ZVJVFTPCTPPXCS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|