C16H21NO4 — CID 102378420
benzyl (2R,6S)-2,6-dimethoxy-5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102378420) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl (2R,6S)-2,6-dimethoxy-5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2R,6S)-2,6-dimethoxy-5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102378420 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | benzyl (2R,6S)-2,6-dimethoxy-5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CO[C@@H]1CC=C(C)[C@H](OC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-12-9-10-14(19-2)17(15(12)20-3)16(18)21-11-13-7-5-4-6-8-13/h4-9,14-15H,10-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | JZFVKXLNQQZMOJ-CABCVRRESA-N |
| XLogP | 2.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|