C22H29NO9 — CID 102380183
1-O-tert-butyl 3-O-ethyl 6-O,7-O-dimethyl (3aS,7aR)-2-(2-hydroxyethyl)-3a,7a-dihydroindole-1,3,6,7-tetracarboxylate (PubChem CID 102380183) has the molecular formula C22H29NO9 and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 6-O,7-O-dimethyl (3aS,7aR)-2-(2-hydroxyethyl)-3a,7a-dihydroindole-1,3,6,7-tetracarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 6-O,7-O-dimethyl (3aS,7aR)-2-(2-hydroxyethyl)-3a,7a-dihydroindole-1,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 102380183 |
| Molecular Formula | C22H29NO9 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 6-O,7-O-dimethyl (3aS,7aR)-2-(2-hydroxyethyl)-3a,7a-dihydroindole-1,3,6,7-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(CCO)N(C(=O)OC(C)(C)C)[C@H]2C(C(=O)OC)=C(C(=O)OC)C=C[C@@H]12 |
| InChI | InChI=1S/C22H29NO9/c1-7-31-20(27)15-12-8-9-13(18(25)29-5)16(19(26)30-6)17(12)23(14(15)10-11-24)21(28)32-22(2,3)4/h8-9,12,17,24H,7,10-11H2,1-6H3/t12-,17+/m0/s1 |
| InChIKey | PFGJVOWJFCHQPL-YVEFUNNKSA-N |
| XLogP | 1.63 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|