C17H28BFO2 — CID 102380425
2-[(1E,3E)-5-cyclohexyl-4-fluoropenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102380425) has the molecular formula C17H28BFO2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[(1E,3E)-5-cyclohexyl-4-fluoropenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E,3E)-5-cyclohexyl-4-fluoropenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102380425 |
| Molecular Formula | C17H28BFO2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[(1E,3E)-5-cyclohexyl-4-fluoropenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C/C=C(/F)CC2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C17H28BFO2/c1-16(2)17(3,4)21-18(20-16)12-8-11-15(19)13-14-9-6-5-7-10-14/h8,11-12,14H,5-7,9-10,13H2,1-4H3/b12-8+,15-11+ |
| InChIKey | JNZZAJMDAKZQNB-HRVWGNOLSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|