C16H24BFO2 — CID 155583765
2-[(1Z,5E,7Z)-6-fluorocycloocta-1,5,7-trien-1-yl]-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 155583765) has the molecular formula C16H24BFO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[(1Z,5E,7Z)-6-fluorocycloocta-1,5,7-trien-1-yl]-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1Z,5E,7Z)-6-fluorocycloocta-1,5,7-trien-1-yl]-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155583765 |
| Molecular Formula | C16H24BFO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[(1Z,5E,7Z)-6-fluorocycloocta-1,5,7-trien-1-yl]-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)C1(C)OB(C2=C/CC/C=C(F)/C=C\2)OC1(C)C |
| InChI | InChI=1S/C16H24BFO2/c1-12(2)16(5)15(3,4)19-17(20-16)13-8-6-7-9-14(18)11-10-13/h8-12H,6-7H2,1-5H3/b11-10-,13-8+,14-9+ |
| InChIKey | SLIUTHMHFKXWLD-NYISFFQWSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|