C16H23BO — CID 10681980
(3aR,4Z,6Z,8Z,9aR)-1-cyclopentyl-3,3-bis(trideuteriomethyl)-3a,9a-dihydrocycloocta[c]oxaborole (PubChem CID 10681980) has the molecular formula C16H23BO and a molecular weight of 248.21 g/mol. Its IUPAC name is (3aR,4Z,6Z,8Z,9aR)-1-cyclopentyl-3,3-bis(trideuteriomethyl)-3a,9a-dihydrocycloocta[c]oxaborole.
| Compound Name | (3aR,4Z,6Z,8Z,9aR)-1-cyclopentyl-3,3-bis(trideuteriomethyl)-3a,9a-dihydrocycloocta[c]oxaborole |
|---|---|
| PubChem CID | 10681980 |
| Molecular Formula | C16H23BO |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.22 |
| IUPAC Name | (3aR,4Z,6Z,8Z,9aR)-1-cyclopentyl-3,3-bis(trideuteriomethyl)-3a,9a-dihydrocycloocta[c]oxaborole |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])OB(C2CCCC2)[C@@H]2/C=C\C=C/C=C\[C@@H]21 |
| InChI | InChI=1S/C16H23BO/c1-16(2)14-11-5-3-4-6-12-15(14)17(18-16)13-9-7-8-10-13/h3-6,11-15H,7-10H2,1-2H3/b4-3-,11-5-,12-6-/t14-,15+/m0/s1/i1D3,2D3 |
| InChIKey | VKBDOBWOODSWGM-ONYSGANLSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|