C19H19NO5S — CID 102381034
N-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-4-methylbenzenesulfonamide (PubChem CID 102381034) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102381034 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-4-methylbenzenesulfonamide |
| SMILES | COc1ccc2c(C)c(NS(=O)(=O)c3ccc(C)cc3)c(=O)oc2c1C |
| InChI | InChI=1S/C19H19NO5S/c1-11-5-7-14(8-6-11)26(22,23)20-17-12(2)15-9-10-16(24-4)13(3)18(15)25-19(17)21/h5-10,20H,1-4H3 |
| InChIKey | JPWSDFIWTSUAJK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|