C15H16N2O2 — CID 102381641
(3S,6S)-3-phenyl-1,4-diazaspiro[5.5]undec-9-ene-2,5-dione (PubChem CID 102381641) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (3S,6S)-3-phenyl-1,4-diazaspiro[5.5]undec-9-ene-2,5-dione.
| Compound Name | (3S,6S)-3-phenyl-1,4-diazaspiro[5.5]undec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 102381641 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3S,6S)-3-phenyl-1,4-diazaspiro[5.5]undec-9-ene-2,5-dione |
| SMILES | O=C1N[C@@]2(CC=CCC2)C(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c18-13-12(11-7-3-1-4-8-11)16-14(19)15(17-13)9-5-2-6-10-15/h1-5,7-8,12H,6,9-10H2,(H,16,19)(H,17,18)/t12-,15+/m0/s1 |
| InChIKey | QFMFJYGAKRBUHN-SWLSCSKDSA-N |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|