C10H14FNO4 — CID 102382247
3-[(E)-3-fluoro-4-hydroxyhept-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102382247) has the molecular formula C10H14FNO4 and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-[(E)-3-fluoro-4-hydroxyhept-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-3-fluoro-4-hydroxyhept-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102382247 |
| Molecular Formula | C10H14FNO4 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-[(E)-3-fluoro-4-hydroxyhept-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCC(O)/C(F)=C\C(=O)N1CCOC1=O |
| InChI | InChI=1S/C10H14FNO4/c1-2-3-8(13)7(11)6-9(14)12-4-5-16-10(12)15/h6,8,13H,2-5H2,1H3/b7-6+ |
| InChIKey | NWLXFSVHORHECD-VOTSOKGWSA-N |
| XLogP | 0.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|