C7H6F3NO3 — CID 45140680
3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 45140680) has the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. Its IUPAC name is 3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 45140680 |
| Molecular Formula | C7H6F3NO3 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/C(F)(F)F)N1CCOC1=O |
| InChI | InChI=1S/C7H6F3NO3/c8-7(9,10)2-1-5(12)11-3-4-14-6(11)13/h1-2H,3-4H2/b2-1+ |
| InChIKey | IHPXBMQXKVJKIR-OWOJBTEDSA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|