C35H28N2O7S — CID 102383996
methyl 2-[1-(benzenesulfonyl)-3-[2-formyl-1-[(4-methoxyphenyl)methyl]indole-3-carbonyl]indol-2-yl]acetate (PubChem CID 102383996) has the molecular formula C35H28N2O7S and a molecular weight of 620.68 g/mol. Its IUPAC name is methyl 2-[1-(benzenesulfonyl)-3-[2-formyl-1-[(4-methoxyphenyl)methyl]indole-3-carbonyl]indol-2-yl]acetate.
| Compound Name | methyl 2-[1-(benzenesulfonyl)-3-[2-formyl-1-[(4-methoxyphenyl)methyl]indole-3-carbonyl]indol-2-yl]acetate |
|---|---|
| PubChem CID | 102383996 |
| Molecular Formula | C35H28N2O7S |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | methyl 2-[1-(benzenesulfonyl)-3-[2-formyl-1-[(4-methoxyphenyl)methyl]indole-3-carbonyl]indol-2-yl]acetate |
| SMILES | COC(=O)Cc1c(C(=O)c2c(C=O)n(Cc3ccc(OC)cc3)c3ccccc23)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O7S/c1-43-24-18-16-23(17-19-24)21-36-28-14-8-6-12-26(28)34(31(36)22-38)35(40)33-27-13-7-9-15-29(27)37(30(33)20-32(39)44-2)45(41,42)25-10-4-3-5-11-25/h3-19,22H,20-21H2,1-2H3 |
| InChIKey | GJSJRQGJTQRHIP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 113.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|