C12H18O2 — CID 102384281
4-methoxy-2-propyl-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 102384281) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-methoxy-2-propyl-4,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 4-methoxy-2-propyl-4,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 102384281 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-methoxy-2-propyl-4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CCCc1cc2c(o1)CCCC2OC |
| InChI | InChI=1S/C12H18O2/c1-3-5-9-8-10-11(13-2)6-4-7-12(10)14-9/h8,11H,3-7H2,1-2H3 |
| InChIKey | SEGXZUSVPOGUIE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |