C13H18O3 — CID 54175180
1-methoxy-6-(methylperoxymethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 54175180) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-methoxy-6-(methylperoxymethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-methoxy-6-(methylperoxymethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 54175180 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-methoxy-6-(methylperoxymethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COOCc1ccc2c(c1)CCCC2OC |
| InChI | InChI=1S/C13H18O3/c1-14-13-5-3-4-11-8-10(9-16-15-2)6-7-12(11)13/h6-8,13H,3-5,9H2,1-2H3 |
| InChIKey | OXULFXIGYFVAHO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|