C23H27NO3S2 — CID 143157639
S-[2-[4-[2-(5-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]sulfanylphenyl]-2-oxoethyl] ethanethioate (PubChem CID 143157639) has the molecular formula C23H27NO3S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is S-[2-[4-[2-(5-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]sulfanylphenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[2-(5-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]sulfanylphenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 143157639 |
| Molecular Formula | C23H27NO3S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | S-[2-[4-[2-(5-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]sulfanylphenyl]-2-oxoethyl] ethanethioate |
| SMILES | COC1CCCc2cc(CCNSc3ccc(C(=O)CSC(C)=O)cc3)ccc21 |
| InChI | InChI=1S/C23H27NO3S2/c1-16(25)28-15-22(26)18-7-9-20(10-8-18)29-24-13-12-17-6-11-21-19(14-17)4-3-5-23(21)27-2/h6-11,14,23-24H,3-5,12-13,15H2,1-2H3 |
| InChIKey | HJXXLUGVSMWORB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|