C20H23NO2 — CID 57297628
N-hydroxy-N-[6-(2-phenylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 57297628) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-hydroxy-N-[6-(2-phenylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-hydroxy-N-[6-(2-phenylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 57297628 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-hydroxy-N-[6-(2-phenylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CC(=O)N(O)C1CCCc2cc(CCc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H23NO2/c1-15(22)21(23)20-9-5-8-18-14-17(12-13-19(18)20)11-10-16-6-3-2-4-7-16/h2-4,6-7,12-14,20,23H,5,8-11H2,1H3 |
| InChIKey | YECQETKDBOOLCC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|