C19H22 — CID 91436521
1,2-dimethyl-5-(2-phenylethyl)-2,3-dihydro-1H-indene (PubChem CID 91436521) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,2-dimethyl-5-(2-phenylethyl)-2,3-dihydro-1H-indene.
| Compound Name | 1,2-dimethyl-5-(2-phenylethyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 91436521 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1,2-dimethyl-5-(2-phenylethyl)-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2cc(CCc3ccccc3)ccc2C1C |
| InChI | InChI=1S/C19H22/c1-14-12-18-13-17(10-11-19(18)15(14)2)9-8-16-6-4-3-5-7-16/h3-7,10-11,13-15H,8-9,12H2,1-2H3 |
| InChIKey | QOPLSUWZKIVQQF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |