C26H50O2SiSn — CID 59889267
tert-butyl-dimethyl-[(2-tributylstannyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxy]silane (PubChem CID 59889267) has the molecular formula C26H50O2SiSn and a molecular weight of 541.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2-tributylstannyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2-tributylstannyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxy]silane |
|---|---|
| PubChem CID | 59889267 |
| Molecular Formula | C26H50O2SiSn |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | tert-butyl-dimethyl-[(2-tributylstannyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc2c(o1)CCCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H23O2Si.3C4H9.Sn/c1-14(2,3)17(4,5)16-13-8-6-7-12-11(13)9-10-15-12;3*1-3-4-2;/h9,13H,6-8H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | QQKJBWZEZSNELJ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|