C8H11NOS2 — CID 102384932
2-(1,3-dithian-2-yl)-3-oxobutanenitrile (PubChem CID 102384932) has the molecular formula C8H11NOS2 and a molecular weight of 201.32 g/mol. Its IUPAC name is 2-(1,3-dithian-2-yl)-3-oxobutanenitrile.
| Compound Name | 2-(1,3-dithian-2-yl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 102384932 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 2-(1,3-dithian-2-yl)-3-oxobutanenitrile |
| SMILES | CC(=O)C(C#N)C1SCCCS1 |
| InChI | InChI=1S/C8H11NOS2/c1-6(10)7(5-9)8-11-3-2-4-12-8/h7-8H,2-4H2,1H3 |
| InChIKey | TXNHUNSMDBQYRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |