C6H11NO2S2 — CID 174987855
1,3-dithian-2-yl(methyl)carbamic acid (PubChem CID 174987855) has the molecular formula C6H11NO2S2 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,3-dithian-2-yl(methyl)carbamic acid.
| Compound Name | 1,3-dithian-2-yl(methyl)carbamic acid |
|---|---|
| PubChem CID | 174987855 |
| Molecular Formula | C6H11NO2S2 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 1,3-dithian-2-yl(methyl)carbamic acid |
| SMILES | CN(C(=O)O)C1SCCCS1 |
| InChI | InChI=1S/C6H11NO2S2/c1-7(5(8)9)6-10-3-2-4-11-6/h6H,2-4H2,1H3,(H,8,9) |
| InChIKey | LLZHTIWDZNZCHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |