About diphenylmethanone;2-methyl-1,3-dithiane
diphenylmethanone;2-methyl-1,3-dithiane (PubChem CID 87291576) has the molecular formula C18H20OS2
and a molecular weight of 316.49 g/mol. Its IUPAC name is diphenylmethanone;2-methyl-1,3-dithiane.
Molecular Properties
| Compound Name | diphenylmethanone;2-methyl-1,3-dithiane |
| PubChem CID | 87291576 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | diphenylmethanone;2-methyl-1,3-dithiane |
| SMILES | CC1SCCCS1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C5H10S2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-6-3-2-4-7-5/h1-10H;5H,2-4H2,1H3 |
| InChIKey | QEDUAVRUPBBQJO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diphenylmethanone;2-methyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;2-methyl-1,3-dithiane?
The IUPAC name of diphenylmethanone;2-methyl-1,3-dithiane (CID 87291576) is diphenylmethanone;2-methyl-1,3-dithiane.
What is the SMILES notation for diphenylmethanone;2-methyl-1,3-dithiane?
The canonical SMILES for diphenylmethanone;2-methyl-1,3-dithiane is CC1SCCCS1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;2-methyl-1,3-dithiane?
The InChIKey is QEDUAVRUPBBQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C5H10S2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-6-3-2-4-7-5/h1-10H;5H,2-4H2,1H3.
What are the key properties of diphenylmethanone;2-methyl-1,3-dithiane?
diphenylmethanone;2-methyl-1,3-dithiane has a molecular weight of 316.49 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;2-methyl-1,3-dithiane is sourced from PubChem (CID 87291576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).