C20H20O3 — CID 102386205
(3S,4R)-3-ethyl-4-(4-methoxyphenyl)-6-phenyl-3,4-dihydropyran-2-one (PubChem CID 102386205) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3S,4R)-3-ethyl-4-(4-methoxyphenyl)-6-phenyl-3,4-dihydropyran-2-one.
| Compound Name | (3S,4R)-3-ethyl-4-(4-methoxyphenyl)-6-phenyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 102386205 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (3S,4R)-3-ethyl-4-(4-methoxyphenyl)-6-phenyl-3,4-dihydropyran-2-one |
| SMILES | CC[C@@H]1C(=O)OC(c2ccccc2)=C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20O3/c1-3-17-18(14-9-11-16(22-2)12-10-14)13-19(23-20(17)21)15-7-5-4-6-8-15/h4-13,17-18H,3H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | HHWKGZOCBSNVKK-ROUUACIJSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |