C20H17Cl3O3 — CID 122214413
(3S,4S)-3-benzyl-4-(4-methoxyphenyl)-6-(trichloromethyl)-3,4-dihydropyran-2-one (PubChem CID 122214413) has the molecular formula C20H17Cl3O3 and a molecular weight of 411.71 g/mol. Its IUPAC name is (3S,4S)-3-benzyl-4-(4-methoxyphenyl)-6-(trichloromethyl)-3,4-dihydropyran-2-one.
| Compound Name | (3S,4S)-3-benzyl-4-(4-methoxyphenyl)-6-(trichloromethyl)-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 122214413 |
| Molecular Formula | C20H17Cl3O3 |
| Molecular Weight | 411.71 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | (3S,4S)-3-benzyl-4-(4-methoxyphenyl)-6-(trichloromethyl)-3,4-dihydropyran-2-one |
| SMILES | COc1ccc([C@H]2C=C(C(Cl)(Cl)Cl)OC(=O)[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H17Cl3O3/c1-25-15-9-7-14(8-10-15)16-12-18(20(21,22)23)26-19(24)17(16)11-13-5-3-2-4-6-13/h2-10,12,16-17H,11H2,1H3/t16-,17+/m1/s1 |
| InChIKey | YLTPSRUOZULWQR-SJORKVTESA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|