C26H23F3NOP — CID 102386716
(2R)-N-diphenylphosphoryl-1,1,1-trifluoro-2-naphthalen-2-ylbutan-2-amine (PubChem CID 102386716) has the molecular formula C26H23F3NOP and a molecular weight of 453.44 g/mol. Its IUPAC name is (2R)-N-diphenylphosphoryl-1,1,1-trifluoro-2-naphthalen-2-ylbutan-2-amine.
| Compound Name | (2R)-N-diphenylphosphoryl-1,1,1-trifluoro-2-naphthalen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 102386716 |
| Molecular Formula | C26H23F3NOP |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (2R)-N-diphenylphosphoryl-1,1,1-trifluoro-2-naphthalen-2-ylbutan-2-amine |
| SMILES | CC[C@@](NP(=O)(c1ccccc1)c1ccccc1)(c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C26H23F3NOP/c1-2-25(26(27,28)29,22-18-17-20-11-9-10-12-21(20)19-22)30-32(31,23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-19H,2H2,1H3,(H,30,31)/t25-/m1/s1 |
| InChIKey | OOMTVFQNKVKALZ-RUZDIDTESA-N |
| XLogP | 6.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|