C22H34N2O6 — CID 102387473
9,9,20,20-tetramethyl-7,18-dioxa-11,22-diazadispiro[4.6.412.65]docosane-6,10,17,21-tetrone (PubChem CID 102387473) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is 9,9,20,20-tetramethyl-7,18-dioxa-11,22-diazadispiro[4.6.412.65]docosane-6,10,17,21-tetrone.
| Compound Name | 9,9,20,20-tetramethyl-7,18-dioxa-11,22-diazadispiro[4.6.412.65]docosane-6,10,17,21-tetrone |
|---|---|
| PubChem CID | 102387473 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 9,9,20,20-tetramethyl-7,18-dioxa-11,22-diazadispiro[4.6.412.65]docosane-6,10,17,21-tetrone |
| SMILES | CC1(C)COC(=O)C2(CCCC2)NC(=O)C(C)(C)COC(=O)C2(CCCC2)NC1=O |
| InChI | InChI=1S/C22H34N2O6/c1-19(2)13-29-17(27)22(11-7-8-12-22)24-16(26)20(3,4)14-30-18(28)21(23-15(19)25)9-5-6-10-21/h5-14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | RAUOLAULVCOQSC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |