C18H22ClNO2 — CID 139825783
3-chloro-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 139825783) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 3-chloro-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-chloro-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 139825783 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-chloro-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(C)c(C2(Cl)C(=O)NC3(CCCCC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C18H22ClNO2/c1-11-9-12(2)14(13(3)10-11)18(19)15(21)17(20-16(18)22)7-5-4-6-8-17/h9-10H,4-8H2,1-3H3,(H,20,22) |
| InChIKey | CESFCQLJWYJUQU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|