C14H17ClN2O2 — CID 21262189
4-chloro-1,2-dimethyl-4-(2,4,6-trimethylphenyl)pyrazolidine-3,5-dione (PubChem CID 21262189) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 4-chloro-1,2-dimethyl-4-(2,4,6-trimethylphenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-chloro-1,2-dimethyl-4-(2,4,6-trimethylphenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 21262189 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-chloro-1,2-dimethyl-4-(2,4,6-trimethylphenyl)pyrazolidine-3,5-dione |
| SMILES | Cc1cc(C)c(C2(Cl)C(=O)N(C)N(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-8-6-9(2)11(10(3)7-8)14(15)12(18)16(4)17(5)13(14)19/h6-7H,1-5H3 |
| InChIKey | OSJFPUFGCKLRKZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|