C11H8F4O2 — CID 58660752
1,1,4,4-tetrafluoro-5,7-dimethylisochromen-3-one (PubChem CID 58660752) has the molecular formula C11H8F4O2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1,1,4,4-tetrafluoro-5,7-dimethylisochromen-3-one.
| Compound Name | 1,1,4,4-tetrafluoro-5,7-dimethylisochromen-3-one |
|---|---|
| PubChem CID | 58660752 |
| Molecular Formula | C11H8F4O2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 1,1,4,4-tetrafluoro-5,7-dimethylisochromen-3-one |
| SMILES | Cc1cc(C)c2c(c1)C(F)(F)OC(=O)C2(F)F |
| InChI | InChI=1S/C11H8F4O2/c1-5-3-6(2)8-7(4-5)11(14,15)17-9(16)10(8,12)13/h3-4H,1-2H3 |
| InChIKey | WKTHMNLPQAKCHW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |