C13H16O2 — CID 92982290
(3S)-3-ethyl-3,4,6-trimethyl-2-benzofuran-1-one (PubChem CID 92982290) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3S)-3-ethyl-3,4,6-trimethyl-2-benzofuran-1-one.
| Compound Name | (3S)-3-ethyl-3,4,6-trimethyl-2-benzofuran-1-one |
|---|---|
| PubChem CID | 92982290 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3S)-3-ethyl-3,4,6-trimethyl-2-benzofuran-1-one |
| SMILES | CC[C@]1(C)OC(=O)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C13H16O2/c1-5-13(4)11-9(3)6-8(2)7-10(11)12(14)15-13/h6-7H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | RABBLTKQCWTBAJ-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |