C10H11NO2 — CID 165381210
(7S)-2-deuterio-7-ethyl-7-methylfuro[3,4-b]pyridin-5-one (PubChem CID 165381210) has the molecular formula C10H11NO2 and a molecular weight of 178.21 g/mol. Its IUPAC name is (7S)-2-deuterio-7-ethyl-7-methylfuro[3,4-b]pyridin-5-one.
| Compound Name | (7S)-2-deuterio-7-ethyl-7-methylfuro[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 165381210 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (7S)-2-deuterio-7-ethyl-7-methylfuro[3,4-b]pyridin-5-one |
| SMILES | [2H]c1ccc2c(n1)[C@](C)(CC)OC2=O |
| InChI | InChI=1S/C10H11NO2/c1-3-10(2)8-7(9(12)13-10)5-4-6-11-8/h4-6H,3H2,1-2H3/t10-/m0/s1/i6D |
| InChIKey | XQXOSRJALLTOJU-GLZMELHZSA-N |
| XLogP | 1.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |