C8H12O4 — CID 165098325
3,3-dimethyloxetan-2-one;ethenone;formaldehyde (PubChem CID 165098325) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3,3-dimethyloxetan-2-one;ethenone;formaldehyde.
| Compound Name | 3,3-dimethyloxetan-2-one;ethenone;formaldehyde |
|---|---|
| PubChem CID | 165098325 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3,3-dimethyloxetan-2-one;ethenone;formaldehyde |
| SMILES | C=C=O.C=O.CC1(C)COC1=O |
| InChI | InChI=1S/C5H8O2.C2H2O.CH2O/c1-5(2)3-7-4(5)6;1-2-3;1-2/h3H2,1-2H3;1H2;1H2 |
| InChIKey | XWWHWEWHHJLVMQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|