C13H13NO2 — CID 102388817
(4R,4aR,7aR)-2-oxido-4-phenyl-4,4a,7,7a-tetrahydrocyclopenta[e]oxazin-2-ium (PubChem CID 102388817) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4R,4aR,7aR)-2-oxido-4-phenyl-4,4a,7,7a-tetrahydrocyclopenta[e]oxazin-2-ium.
| Compound Name | (4R,4aR,7aR)-2-oxido-4-phenyl-4,4a,7,7a-tetrahydrocyclopenta[e]oxazin-2-ium |
|---|---|
| PubChem CID | 102388817 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (4R,4aR,7aR)-2-oxido-4-phenyl-4,4a,7,7a-tetrahydrocyclopenta[e]oxazin-2-ium |
| SMILES | [O-][N+]1=C[C@@H](c2ccccc2)[C@H]2C=CC[C@H]2O1 |
| InChI | InChI=1S/C13H13NO2/c15-14-9-12(10-5-2-1-3-6-10)11-7-4-8-13(11)16-14/h1-7,9,11-13H,8H2/t11-,12+,13-/m1/s1 |
| InChIKey | FBGACVOIKPKCQI-FRRDWIJNSA-N |
| XLogP | 2.24 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|