C13H14O — CID 102485646
2-[(1R)-2-phenylcyclopent-3-en-1-yl]acetaldehyde (PubChem CID 102485646) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(1R)-2-phenylcyclopent-3-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1R)-2-phenylcyclopent-3-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 102485646 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-[(1R)-2-phenylcyclopent-3-en-1-yl]acetaldehyde |
| SMILES | O=CC[C@H]1CC=CC1c1ccccc1 |
| InChI | InChI=1S/C13H14O/c14-10-9-12-7-4-8-13(12)11-5-2-1-3-6-11/h1-6,8,10,12-13H,7,9H2/t12-,13?/m1/s1 |
| InChIKey | ROWCBAZTGJAIBA-PZORYLMUSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|