C19H11Cl2N7Na2O6S2 — CID 102389678
disodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)diazenyl]-3-(2-phenylhydrazinyl)naphthalene-2,7-disulfonate (PubChem CID 102389678) has the molecular formula C19H11Cl2N7Na2O6S2 and a molecular weight of 614.36 g/mol. Its IUPAC name is disodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)diazenyl]-3-(2-phenylhydrazinyl)naphthalene-2,7-disulfonate.
| Compound Name | disodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)diazenyl]-3-(2-phenylhydrazinyl)naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 102389678 |
| Molecular Formula | C19H11Cl2N7Na2O6S2 |
| Molecular Weight | 614.36 g/mol |
| Exact Mass | 612.94 |
| IUPAC Name | disodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)diazenyl]-3-(2-phenylhydrazinyl)naphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(/N=N/c2nc(Cl)nc(Cl)n2)c2cc(NNc3ccccc3)c(S(=O)(=O)[O-])cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C19H13Cl2N7O6S2.2Na/c20-17-22-18(21)24-19(23-17)28-26-14-8-12(35(29,30)31)6-10-7-16(36(32,33)34)15(9-13(10)14)27-25-11-4-2-1-3-5-11;;/h1-9,25,27H,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2/b28-26+;; |
| InChIKey | WMWMOALOYICDGE-ZUUFXJLRSA-L |
| XLogP | -2.00 |
| TPSA | 201.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.36 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|