C28H38N4O5S3 — CID 102390251
(2S)-2-[[(2R)-2-[(4-aminobenzoyl)amino]-3-[(7-anilino-7-oxoheptyl)disulfanyl]propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 102390251) has the molecular formula C28H38N4O5S3 and a molecular weight of 606.84 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[(4-aminobenzoyl)amino]-3-[(7-anilino-7-oxoheptyl)disulfanyl]propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[(4-aminobenzoyl)amino]-3-[(7-anilino-7-oxoheptyl)disulfanyl]propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 102390251 |
| Molecular Formula | C28H38N4O5S3 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | (2S)-2-[[(2R)-2-[(4-aminobenzoyl)amino]-3-[(7-anilino-7-oxoheptyl)disulfanyl]propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CSSCCCCCCC(=O)Nc1ccccc1)NC(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C28H38N4O5S3/c1-38-18-16-23(28(36)37)31-27(35)24(32-26(34)20-12-14-21(29)15-13-20)19-40-39-17-8-3-2-7-11-25(33)30-22-9-5-4-6-10-22/h4-6,9-10,12-15,23-24H,2-3,7-8,11,16-19,29H2,1H3,(H,30,33)(H,31,35)(H,32,34)(H,36,37)/t23-,24-/m0/s1 |
| InChIKey | VNEJOSZGCUCSFW-ZEQRLZLVSA-N |
| XLogP | 4.66 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|